EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48 |
| Net Charge | 0 |
| Average Mass | 408.714 |
| Monoisotopic Mass | 408.37560 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CC=C2C(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H48/c1-23(2)11-8-12-24(3)15-10-16-27(6)28-20-22-30(7)21-19-26(5)14-9-13-25(4)17-18-29(28)30/h11,13,15,19-20,27,29H,8-10,12,14,16-18,21-22H2,1-7H3/b24-15+,25-13+,26-19+/t27?,29-,30-/m0/s1 |
| InChIKey | VVHPNQSUMLARNW-NGCRBCODSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talaropentaene (CHEBI:192978) has role fungal metabolite (CHEBI:76946) |
| talaropentaene (CHEBI:192978) is a carbobicyclic compound (CHEBI:36785) |
| talaropentaene (CHEBI:192978) is a polycyclic olefin (CHEBI:35714) |
| talaropentaene (CHEBI:192978) is a triterpene (CHEBI:35191) |
| IUPAC Name |
|---|
| (3aR,6E,10E,12aS)-3-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]-6,10,12a-trimethyl-1,3a,4,5,8,9,12,12a-octahydrocyclopenta[11]annulene |
| UniProt Name | Source |
|---|---|
| talaropentaene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26702 | MetaCyc |
| Citations |
|---|