EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@H](C)[C@]1([H])[C@@]1([H])[C@@H](C(=C)C)CC[C@@]21C |
| InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)13(12)14(11)15/h10-14H,1,5-8H2,2-4H3/t10-,11+,12+,13-,14+,15-/m0/s1 |
| InChIKey | KZVOHANKAKKFOK-MTWVNVMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cymbastela hooperi (WORMS:165531) | - | DOI (10.1021/jo970015o) | |
| Magnolia officinalis (ncbitaxon:85864) | bark (BTO:0001301) | PubMed (34159200) | |
| Ptychanthus striatus (ncbitaxon:203655) | cell culture (BTO:0000214) | PubMed (26300167) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prespatane (CHEBI:192977) has role animal metabolite (CHEBI:75767) |
| prespatane (CHEBI:192977) has role marine metabolite (CHEBI:76507) |
| prespatane (CHEBI:192977) has role plant metabolite (CHEBI:76924) |
| prespatane (CHEBI:192977) is a carbotricyclic compound (CHEBI:38032) |
| prespatane (CHEBI:192977) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,3aS,3bR,6S,6aS,6bS)-3a,6-dimethyl-1-(prop-1-en-2-yl)decahydrocyclobuta[1,2-a:3,4-a']dicyclopentene |
| Citations |
|---|