EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CCC(=C)C=C1[C@H](C(C)C)CC[C@H]2C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,12-14H,3,5-8H2,1-2,4H3/t12-,13+,14+/m1/s1 |
| InChIKey | RNDFUOKDULDZPR-RDBSUJKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ocimum basilicum (ncbitaxon:39350) | - | DOI (10.1016/0031-9422(74)80097-X) | |
| Pinus nigra (ncbitaxon:58042) | - | DOI (10.1080/10412905.1996.9700644) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-epi-bicyclosesquiphellandrene (CHEBI:192967) has role plant metabolite (CHEBI:76924) |
| 1-epi-bicyclosesquiphellandrene (CHEBI:192967) has role volatile oil component (CHEBI:27311) |
| 1-epi-bicyclosesquiphellandrene (CHEBI:192967) is a octahydronaphthalenes (CHEBI:138397) |
| 1-epi-bicyclosesquiphellandrene (CHEBI:192967) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,4R,4aS)-4-methyl-7-methylidene-1-(propan-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| Synonym | Source |
|---|---|
| 1-epibicyclosesquiphellandrene | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00020063 | KNApSAcK |
| FDB016011 | FooDB |
| HMDB0037030 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:54274-73-6 | KNApSAcK |
| Citations |
|---|