EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | CCCCCCC#CC#CC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2-6,9-10,12-13,15-16H2,1H3,(H,20,21) |
| InChIKey | MNEYSZJSCYXZQM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-9,11-octadecadiynoic acid (CHEBI:192956) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 8-oxooctadeca-9,11-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472367 | ChemSpider |
| LMFA01060163 | LIPID MAPS |