EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@@H](O)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H42O3/c1-18-8-12-22(28)17-21(18)11-10-20-7-6-16-27(5)23(13-14-24(20)27)19(2)9-15-25(29)26(3,4)30/h9-11,15,19,22-25,28-30H,1,6-8,12-14,16-17H2,2-5H3/b15-9+,20-10+,21-11-/t19-,22+,23-,24+,25-,27-/m1/s1 |
| InChIKey | NQYKUNLOUXZDEN-IYPBAUNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22E)-(24R)-24,25-dihydroxy-22,23-didehydrovitamin D3 (CHEBI:192952) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (E,3R,6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhept-4-ene-2,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 4446790 | ChemSpider |
| LMST03020178 | LIPID MAPS |