EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O5 |
| Net Charge | 0 |
| Average Mass | 326.433 |
| Monoisotopic Mass | 326.20932 |
| SMILES | [H][C@]1([C@H](O)CC)C[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OO1 |
| InChI | InChI=1S/C18H30O5/c1-2-16(19)17-14-15(22-23-17)12-10-8-6-4-3-5-7-9-11-13-18(20)21/h6,8,10,12,15-17,19H,2-5,7,9,11,13-14H2,1H3,(H,20,21)/b8-6-,12-10+/t15-,16-,17-/m1/s1 |
| InChIKey | NHKZWYFRFFWLDJ-SCISLTCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z,11E)-12-((3S,5R)-5-((R)-1-hydroxypropyl)-1,2-dioxolan-3-yl)dodeca-9,11-dienoic acid (CHEBI:192947) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (9Z,11E)-12-[(3S,5R)-5-[(1R)-1-hydroxypropyl]dioxolan-3-yl]dodeca-9,11-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369415 | ChemSpider |
| LMFA02050001 | LIPID MAPS |