EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | CCCCCCCCCCCC#CCC(=O)O |
| InChI | InChI=1S/C15H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-11,14H2,1H3,(H,16,17) |
| InChIKey | JXPFDNOLLLAYDO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-pentadecynoic acid (CHEBI:192945) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| pentadec-3-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472128 | ChemSpider |
| LMFA01030581 | LIPID MAPS |