EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | C=CCC/C=C/CCCC(=O)O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2,5-6H,1,3-4,7-9H2,(H,11,12)/b6-5+ |
| InChIKey | AWEDVYGPYFSFRJ-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5E,9-decadienoic acid (CHEBI:192944) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (5E)-deca-5,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030211 | LIPID MAPS |
| 4471788 | ChemSpider |