EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O3 |
| Net Charge | 0 |
| Average Mass | 292.419 |
| Monoisotopic Mass | 292.20384 |
| SMILES | CC/C=C\CC(=O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h3,7,9,11-12,15H,2,4-6,8,10,13-14,16H2,1H3,(H,20,21)/b9-7-,11-3-,15-12+ |
| InChIKey | BNMYUQILBYIYOG-JDTPQGGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-keto-9Z,11E,15Z-octadecatrienoic acid (CHEBI:192930) is a octadecatrienoic acid (CHEBI:25633) |
| 13-keto-9Z,11E,15Z-octadecatrienoic acid (CHEBI:192930) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| (9Z,11E,15Z)-13-oxooctadeca-9,11,15-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9601226 | ChemSpider |
| LMFA02000028 | LIPID MAPS |