EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | CCCCC[C@@H]1C(=O)C=C/C1=C/C=C/C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H28O3/c1-2-3-9-13-18-17(15-16-19(18)21)12-10-7-5-4-6-8-11-14-20(22)23/h4,6-7,10,12,15-16,18H,2-3,5,8-9,11,13-14H2,1H3,(H,22,23)/b6-4-,10-7+,17-12-/t18-/m0/s1 |
| InChIKey | JTSWNPYSJJAOQQ-UILHMMCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS3183) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-deoxy-J2-IsoP (CHEBI:192921) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (5Z,8E,10Z)-10-[(5S)-4-oxo-5-pentylcyclopent-2-en-1-ylidene]deca-5,8-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369512 | ChemSpider |
| LMFA03110062 | LIPID MAPS |