EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H74O14 |
| Net Charge | 0 |
| Average Mass | 851.084 |
| Monoisotopic Mass | 850.50786 |
| SMILES | [H][C@]1([C@H](C)CCC=C(C)C)[C@@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](O)[C@H]2O)C[C@@]2(C)C3[C@H](OC)C=C4C(C)(C)C(O[C@@H]5OC[C@@H](O)[C@H](O)[C@H]5O)CC[C@]4([H])[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C46H74O14/c1-23(2)13-12-14-24(3)34-31(58-42-38(53)36(51)39(57-26(5)48)32(59-42)22-55-25(4)47)20-46(10)40-30(54-11)19-28-27(44(40,8)17-18-45(34,46)9)15-16-33(43(28,6)7)60-41-37(52)35(50)29(49)21-56-41/h13,19,24,27,29-42,49-53H,12,14-18,20-22H2,1-11H3/t24-,27+,29-,30-,31+,32-,33?,34+,35+,36+,37-,38-,39-,40?,41+,42-,44+,45-,46+/m1/s1 |
| InChIKey | BDIZCZITXGMZCF-VLBBCCKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cryptomeria (ncbitaxon:3368) | needle (BTO:0000917) | MetaboLights (MTBLS4099) | Strain: Cryptomeria fortunei Hooibrenk |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hebevinoside XI (CHEBI:192863) is a cucurbitacin (CHEBI:16219) |
| Hebevinoside XI (CHEBI:192863) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| [(2R,3S,4S,5R,6R)-3-acetyloxy-4,5-dihydroxy-6-[[(7R,9S,10R,13R,14S,16S,17R)-7-methoxy-4,4,9,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]oxan-2-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 157464 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:101365-13-3 | ChemIDplus |