EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@H]1C/C=C(/C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9,15H,1,5,7-8,10-11H2,2-4H3/b13-6+,14-9-/t15-/m1/s1 |
| InChIKey | XMRKUJJDDKYUHV-SOMPWSNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Magnolia coriacea (ncbitaxon:2876856) | - | PubMed (35236800) | |
| Amitermes wheeleri (ncbitaxon:2904724) | - | DOI (10.1021/np50046a028) | |
| Helminthosporium sativum (ncbitaxon:58127) | - | DOI (10.1021/jo01311a053) |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-helminthogermacrene (CHEBI:192821) has role animal metabolite (CHEBI:75767) |
| (−)-helminthogermacrene (CHEBI:192821) is a helminthogermacrene (CHEBI:192834) |
| (−)-helminthogermacrene (CHEBI:192821) is enantiomer of (+)-helminthogermacrene (CHEBI:192823) |
| Incoming Relation(s) |
| (+)-helminthogermacrene (CHEBI:192823) is enantiomer of (−)-helminthogermacrene (CHEBI:192821) |
| IUPAC Name |
|---|
| (1E,5Z,8R)-1,5-dimethyl-8-(prop-1-en-2-yl)cyclodeca-1,5-diene |
| Synonym | Source |
|---|---|
| helminthogermacrene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00011721 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:75023-40-4 | ChemIDplus |
| Citations |
|---|