EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | [H][C@]12CC(=O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)CCC[C@@]3([H])[C@]1([H])C(=O)C2 |
| InChI | InChI=1S/C19H28O2/c1-18-7-3-4-14(18)17-15(6-8-18)19(2)9-5-13(20)10-12(19)11-16(17)21/h12,14-15,17H,3-11H2,1-2H3/t12-,14+,15+,17+,18+,19+/m1/s1 |
| InChIKey | XFDKSFIFORVRGT-DCYJUTBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phytophthora nicotianae (ncbitaxon:4790) | mycelium (BTO:0001436) | MetaboLights (MTBLS5405) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Androstan-3,7-Dione (CHEBI:192803) has role androgen (CHEBI:50113) |
| 5alpha-Androstan-3,7-Dione (CHEBI:192803) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (5R,8S,9S,10S,13S,14S)-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-dione |