EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41D4NO6S |
| Net Charge | 0 |
| Average Mass | 503.738 |
| Monoisotopic Mass | 503.32187 |
| SMILES | [H][C@@]12CC[C@]3([H])C([2H])([2H])[C@H](O)C([2H])([2H])C[C@]3(C)[C@@]1([H])C[C@H](O)[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C26H45NO6S/c1-16(4-9-24(30)27-12-13-34(31,32)33)20-7-8-21-19-6-5-17-14-18(28)10-11-25(17,2)22(19)15-23(29)26(20,21)3/h16-23,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1/i10D2,14D2 |
| InChIKey | AWDRATDZQPNJFN-QFNLNYLLSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taurodeoxycholic acid-d4 (CHEBI:192787) is a deuterated compound (CHEBI:76107) |
| taurodeoxycholic acid-d4 (CHEBI:192787) is a taurodeoxycholic acid (CHEBI:9410) |