EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | COc1cc(C(=O)OC2CCCCC2)ccc1O |
| InChI | InChI=1S/C14H18O4/c1-17-13-9-10(7-8-12(13)15)14(16)18-11-5-3-2-4-6-11/h7-9,11,15H,2-6H2,1H3 |
| InChIKey | IVEWFDRWBLCGQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mochimganine (CHEBI:192760) has functional parent cyclohexanol (CHEBI:18099) |
| mochimganine (CHEBI:192760) has functional parent vanillic acid (CHEBI:30816) |
| mochimganine (CHEBI:192760) has role geroprotector (CHEBI:176497) |
| mochimganine (CHEBI:192760) is a benzoate ester (CHEBI:36054) |
| mochimganine (CHEBI:192760) is a monomethoxybenzene (CHEBI:25235) |
| mochimganine (CHEBI:192760) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| cyclohexyl 4-hydroxy-3-methoxybenzoate |
| Citations |
|---|