EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192759 - α-neoclovene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=CCC[C@@]2(C)C3CC[C@@]12CC3(C)C |
| InChI | InChI=1S/C15H24/c1-11-6-5-8-14(4)12-7-9-15(11,14)10-13(12,2)3/h6,12H,5,7-10H2,1-4H3/t12?,14-,15+/m0/s1 |
| InChIKey | ZCJQJJWNFDNQGZ-JQXSQYPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anacardium humile (ncbitaxon:1105347) | fruit (BTO:0000486) | DOI (10.1080/10412905.2010.9700374) | |
| Panax ginseng (ncbitaxon:4054) | - | DOI (10.1007/s13765-015-0007-0) | |
| Aralia elata (ncbitaxon:82095) | - | PubMed (27859496) | |
| Elionurus tristis (ncbitaxon:1755047) | leaf (BTO:0000713) | PubMed (30520608) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-neoclovene (CHEBI:192759) has role plant metabolite (CHEBI:76924) |
| α-neoclovene (CHEBI:192759) has role volatile oil component (CHEBI:27311) |
| α-neoclovene (CHEBI:192759) is a an α-neoclovene (CHEBI:193105) |
| α-neoclovene (CHEBI:192759) is a carbotricyclic compound (CHEBI:38032) |
| α-neoclovene (CHEBI:192759) is a polycyclic olefin (CHEBI:35714) |
| α-neoclovene (CHEBI:192759) is a sesquiterpene (CHEBI:35189) |
| Synonyms | Source |
|---|---|
| alpha-neoclovene | ChEBI |
| (−)-α-neoclovene | NIST Chemistry WebBook |
| neoclovene | ChEBI |
| Citations |
|---|