EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N4O3 |
| Net Charge | 0 |
| Average Mass | 336.351 |
| Monoisotopic Mass | 336.12224 |
| SMILES | CN(C)c1ccc2c(c1)OC(N)=C(C#N)C2c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O3/c1-21(2)12-6-7-14-16(9-12)25-18(20)15(10-19)17(14)11-4-3-5-13(8-11)22(23)24/h3-9,17H,20H2,1-2H3 |
| InChIKey | PNHBABGLCCOXEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) has role antineoplastic agent (CHEBI:35610) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) has role apoptosis inducer (CHEBI:68495) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a C-nitro compound (CHEBI:35716) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a aminochromene (CHEBI:38676) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a benzenes (CHEBI:22712) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a nitrile (CHEBI:18379) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a primary amino compound (CHEBI:50994) |
| 2-amino-4-(3-nitrophenyl)-3-cyano-7-(dimethylamino)-4H-chromene (CHEBI:192743) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-amino-7-(dimethylamino)-4-(3-nitrophenyl)-4H-chromene-3-carbonitrile |
| Synonyms | Source |
|---|---|
| 2-amino-7-(dimethylamino)-4-(3-nitrophenyl)-4H-1-benzopyran-3-carbonitrile | IUPAC |
| 3-NC | SUBMITTER |
| Citations |
|---|