EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N6O4S3 |
| Net Charge | 0 |
| Average Mass | 586.765 |
| Monoisotopic Mass | 586.14907 |
| SMILES | CSCCC1NC(=O)c2csc(n2)CNC(=O)C2N=C(OC2C)C(Cc2ccccc2)NC(=O)C2CSC1=N2 |
| InChI | InChI=1S/C26H30N6O4S3/c1-14-21-24(35)27-11-20-28-18(12-38-20)22(33)29-16(8-9-37-2)26-31-19(13-39-26)23(34)30-17(25(32-21)36-14)10-15-6-4-3-5-7-15/h3-7,12,14,16-17,19,21H,8-11,13H2,1-2H3,(H,27,35)(H,29,33)(H,30,34) |
| InChIKey | MLBROOJXUZKDHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus Af293 (ncbitaxon:330879) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS5072) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruclynamide D (CHEBI:192737) is a cyclic peptide (CHEBI:23449) |