EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192723 - L-NIO
| Formula | C7H15N3O2 |
| Net Charge | 0 |
| Average Mass | 173.216 |
| Monoisotopic Mass | 173.11643 |
| SMILES | C/C(N)=N\CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15N3O2/c1-5(8)10-4-2-3-6(9)7(11)12/h6H,2-4,9H2,1H3,(H2,8,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | UYZFAUAYFLEHRC-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaca mulatta (ncbitaxon:9544) | |||
| serum (BTO:0001239) | MetaboLights (MTBLS3388) | ||
| cerebrospinal fluid (BTO:0000237) | MetaboLights (MTBLS3388) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-NIO (CHEBI:192723) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-(1-aminoethylideneamino)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 97098 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:36889-13-1 | ChemIDplus |