EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C62H84N14O6 |
| Net Charge | 0 |
| Average Mass | 1121.446 |
| Monoisotopic Mass | 1120.66983 |
| SMILES | [H][C@@]12CCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N1[C@H](C(=O)N[C@@H](c1ccccc1)c1cn(CCCCc3ccc(CCCCn4cc([C@@H](NC(=O)[C@@H]5CC[C@]6([H])CCCC[C@H](NC(=O)[C@H](C)NC)C(=O)N56)c5ccccc5)nn4)cc3)nn1)CC2 |
| InChI | InChI=1S/C62H84N14O6/c1-41(63-3)57(77)65-49-27-13-11-25-47-33-35-53(75(47)61(49)81)59(79)67-55(45-21-7-5-8-22-45)51-39-73(71-69-51)37-17-15-19-43-29-31-44(32-30-43)20-16-18-38-74-40-52(70-72-74)56(46-23-9-6-10-24-46)68-60(80)54-36-34-48-26-12-14-28-50(62(82)76(48)54)66-58(78)42(2)64-4/h5-10,21-24,29-32,39-42,47-50,53-56,63-64H,11-20,25-28,33-38H2,1-4H3,(H,65,77)(H,66,78)(H,67,79)(H,68,80)/t41-,42-,47-,48-,49-,50-,53-,54-,55-,56-/m0/s1 |
| InChIKey | LGYDZXNSSLRFJS-IOQQVAQYSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SM-164 (CHEBI:192710) has role antineoplastic agent (CHEBI:35610) |
| SM-164 (CHEBI:192710) has role apoptosis inducer (CHEBI:68495) |
| SM-164 (CHEBI:192710) has role radiosensitizing agent (CHEBI:132992) |
| SM-164 (CHEBI:192710) is a benzenes (CHEBI:22712) |
| SM-164 (CHEBI:192710) is a organic heterobicyclic compound (CHEBI:27171) |
| SM-164 (CHEBI:192710) is a secondary carboxamide (CHEBI:140325) |
| SM-164 (CHEBI:192710) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (3S,6S,10aS)-6-{[(2S)-2-(methylamino)propanoyl]amino}-N-[(S)-(1-{4-[4-(4-{4-[(S)-({[(3S,6S,10aS)-6-{[(2S)-2-(methylamino)propanoyl]amino}-5-oxodecahydropyrrolo[1,2-a]azocin-3-yl]carbonyl}amino)(phenyl)methyl]-1H-1,2,3-triazol-1-yl}butyl)phenyl]butyl}-1H-1,2,3-triazol-4-yl)(phenyl)methyl]-5-oxodecahydropyrrolo[1,2-a]azocine-3-carboxamide |
| Synonyms | Source |
|---|---|
| SM 164 | ChEBI |
| SM164 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:957135-43-2 | ChemIDplus |
| Citations |
|---|