EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192683 - emindole SB
| Formula | C28H39NO |
| Net Charge | 0 |
| Average Mass | 405.626 |
| Monoisotopic Mass | 405.30316 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C)(CC[C@]([H])(O)[C@@]3(C)CCC=C(C)C)[C@@]1(C)c1nc3ccccc3c1C2 |
| InChI | InChI=1S/C28H39NO/c1-18(2)9-8-15-26(3)23-13-12-19-17-21-20-10-6-7-11-22(20)29-25(21)28(19,5)27(23,4)16-14-24(26)30/h6-7,9-11,19,23-24,29-30H,8,12-17H2,1-5H3/t19-,23-,24-,26-,27-,28+/m0/s1 |
| InChIKey | XOLHQUYGSUGTQA-DFGZTGKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | mycelium (BTO:0001436) | PubMed (34096406) | |
| Aspergillus cejpii (ncbitaxon:1884262) | - | PubMed (24471526) | Species also known as Dichotomomyces cejpii. |
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (23311903) | Strain: NSAR1 |
| Penicillium camemberti (ncbitaxon:5075) | - | PubMed (23886345) | Strain: OUCMDZ-1492 |
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (31188002) | Strain: KFD28 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emindole SB (CHEBI:192683) has role Aspergillus metabolite (CHEBI:76956) |
| emindole SB (CHEBI:192683) has role Penicillium metabolite (CHEBI:76964) |
| emindole SB (CHEBI:192683) has role marine metabolite (CHEBI:76507) |
| emindole SB (CHEBI:192683) is a terpenoid indole alkaloid (CHEBI:65321) |
| Synonym | Source |
|---|---|
| emindole-SB | ChEBI |
| UniProt Name | Source |
|---|---|
| emindole-SB | UniProt |
| Citations |
|---|