EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O3 |
| Net Charge | 0 |
| Average Mass | 202.209 |
| Monoisotopic Mass | 202.06299 |
| SMILES | COc1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14) |
| InChIKey | YZBILXXOZFORFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Methoxy-2-naphthoic acid (CHEBI:192675) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 6-methoxynaphthalene-2-carboxylic acid |