EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N3O2 |
| Net Charge | 0 |
| Average Mass | 231.255 |
| Monoisotopic Mass | 231.10078 |
| SMILES | Cn1c(Nc2ccccc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C12H13N3O2/c1-14-10(8-11(16)15(2)12(14)17)13-9-6-4-3-5-7-9/h3-8,13H,1-2H3 |
| InChIKey | OXRNFQWQFJHMDP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-anilino-1,3-dimethyl-1,2,3,4-tetrahydropyrimidine-2,4-dione (CHEBI:192665) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 6-anilino-1,3-dimethylpyrimidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 634603 | ChemSpider |