EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O2 |
| Net Charge | 0 |
| Average Mass | 280.367 |
| Monoisotopic Mass | 280.14633 |
| SMILES | O=C(/C=C/c1ccccc1)CC(O)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,19,21H,12,14-15H2/b13-11+ |
| InChIKey | OUAINJWTDRNZIJ-ACCUITESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1E)-5-hydroxy-1,7-diphenylhept-1-en-3-one (CHEBI:192664) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (E)-5-hydroxy-1,7-diphenylhept-1-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 9383327 | ChemSpider |