EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO |
| Net Charge | 0 |
| Average Mass | 193.290 |
| Monoisotopic Mass | 193.14666 |
| SMILES | CCCCCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-10-14-12-8-6-11(13)7-9-12/h6-9H,2-5,10,13H2,1H3 |
| InChIKey | DJRKHTCUXRGYEU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hexyloxyaniline (CHEBI:192660) is a aromatic ether (CHEBI:35618) |
| 4-Hexyloxyaniline (CHEBI:192660) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-hexoxyaniline |
| Manual Xrefs | Databases |
|---|---|
| 35159 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:39905-57-2 | ChemIDplus |