EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N5OS |
| Net Charge | 0 |
| Average Mass | 365.462 |
| Monoisotopic Mass | 365.13103 |
| SMILES | O=C(Nc1ccccc1)N1CCN(c2nc(-c3ccccc3)ns2)CC1 |
| InChI | InChI=1S/C19H19N5OS/c25-18(20-16-9-5-2-6-10-16)23-11-13-24(14-12-23)19-21-17(22-26-19)15-7-3-1-4-8-15/h1-10H,11-14H2,(H,20,25) |
| InChIKey | BHBOSTKQCZEAJM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JNJ-1661010 (CHEBI:192640) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 2087698 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:681136-29-8 | ChemIDplus |