EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | COc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C10H10O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-7H,1H3,(H,11,12)/b6-5+ |
| InChIKey | LZPNXAULYJPXEH-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methoxycinnamic acid (CHEBI:192607) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3-methoxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 553269 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:03/04/6099 | ChemIDplus |