EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO3 |
| Net Charge | 0 |
| Average Mass | 233.267 |
| Monoisotopic Mass | 233.10519 |
| SMILES | CCOC(=O)c1cc2cc(OCC)ccc2n1 |
| InChI | InChI=1S/C13H15NO3/c1-3-16-10-5-6-11-9(7-10)8-12(14-11)13(15)17-4-2/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | IMFWDOPIAXKRBO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 5-ethoxy-1H-indole-2-carboxylate (CHEBI:192576) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| ethyl 5-ethoxy-1H-indole-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2024439 | ChemSpider |