EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O2 |
| Net Charge | 0 |
| Average Mass | 292.338 |
| Monoisotopic Mass | 292.12118 |
| SMILES | O=C1CCC(c2ccccc2)C(=O)C1=CNc1cccnc1 |
| InChI | InChI=1S/C18H16N2O2/c21-17-9-8-15(13-5-2-1-3-6-13)18(22)16(17)12-20-14-7-4-10-19-11-14/h1-7,10-12,15,20H,8-9H2 |
| InChIKey | UOURICLXARIUSZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phenyl-2-[(3-pyridylamino)methylidene]cyclohexane-1,3-dione (CHEBI:192572) is a aminopyridine (CHEBI:38207) |
| IUPAC Name |
|---|
| 4-phenyl-2-[(pyridin-3-ylamino)methylidene]cyclohexane-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| 3040895 | ChemSpider |