EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O2 |
| Net Charge | 0 |
| Average Mass | 214.309 |
| Monoisotopic Mass | 214.16813 |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | AKVIZYGPJIWKOS-RKDXNWHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2R)-trans-N-Boc-1,2-cyclohexanediamine (CHEBI:192567) is a amine (CHEBI:32952) |
| IUPAC Name |
|---|
| tert-butyl N-[(1R,2R)-2-aminocyclohexyl]carbamate |
| Manual Xrefs | Databases |
|---|---|
| 1246122 | ChemSpider |