EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3S |
| Net Charge | 0 |
| Average Mass | 319.426 |
| Monoisotopic Mass | 319.12421 |
| SMILES | COc1ccc(NCC(O)CSc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-20-15-5-3-13(4-6-15)18-11-14(19)12-22-17-9-7-16(21-2)8-10-17/h3-10,14,18-19H,11-12H2,1-2H3 |
| InChIKey | WOZMFPSJTHTPBW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Valsa sordida (ncbitaxon:252740) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS4463) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-methoxyanilino)-3-[(4-methoxyphenyl)thio]propan-2-ol (CHEBI:192566) is a aromatic ether (CHEBI:35618) |
| 1-(4-methoxyanilino)-3-[(4-methoxyphenyl)thio]propan-2-ol (CHEBI:192566) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 1-(4-methoxyanilino)-3-(4-methoxyphenyl)sulanylpropan-2-ol |
| Manual Xrefs | Databases |
|---|---|
| 2021840 | ChemSpider |