EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O2S |
| Net Charge | 0 |
| Average Mass | 134.200 |
| Monoisotopic Mass | 134.04015 |
| SMILES | CC(=O)SCCCO |
| InChI | InChI=1S/C5H10O2S/c1-5(7)8-4-2-3-6/h6H,2-4H2,1H3 |
| InChIKey | ADIJNQVLNHDJIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis melo (ncbitaxon:3656) | - | PubMed (26212782) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(3-hydroxypropyl)-thioacetate (CHEBI:192554) has functional parent ethanethioic S-acid (CHEBI:16555) |
| S-(3-hydroxypropyl)-thioacetate (CHEBI:192554) has role plant metabolite (CHEBI:76924) |
| S-(3-hydroxypropyl)-thioacetate (CHEBI:192554) is a primary alcohol (CHEBI:15734) |
| S-(3-hydroxypropyl)-thioacetate (CHEBI:192554) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-(3-hydroxypropyl) ethanethioate |
| Synonyms | Source |
|---|---|
| thioacetic acid S-(3-hydroxypropyl) ester | ChEBI |
| 1-[(3-hydroxypropyl)sulfanyl]ethan-1-one | ChEBI |
| 1-[(3-hydroxypropyl)sulfanyl]ethanone | ChEBI |
| ethanethioic acid S-(3-hydroxypropyl) ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:115051-66-6 | ChEBI |
| Citations |
|---|