EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO5 |
| Net Charge | 0 |
| Average Mass | 187.151 |
| Monoisotopic Mass | 187.04807 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)[C@]1([H])OC[C@@]2(N)C(=O)O |
| InChI | InChI=1S/C7H9NO5/c8-7(6(11)12)1-13-4-2(3(4)7)5(9)10/h2-4H,1,8H2,(H,9,10)(H,11,12)/t2-,3-,4+,7+/m1/s1 |
| InChIKey | YASVRZWVUGJELU-MDASVERJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY 379268 (CHEBI:192545) has role antipsychotic agent (CHEBI:35476) |
| LY 379268 (CHEBI:192545) has role anxiolytic drug (CHEBI:35474) |
| LY 379268 (CHEBI:192545) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| LY 379268 (CHEBI:192545) has role neuroprotective agent (CHEBI:63726) |
| LY 379268 (CHEBI:192545) is a amino dicarboxylic acid (CHEBI:36164) |
| LY 379268 (CHEBI:192545) is a bridged compound (CHEBI:35990) |
| LY 379268 (CHEBI:192545) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| (1R,4R,5S,6R)-4-amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| LY-379,268 | ChEBI |
| LY-379268 | ChEBI |
| LY379268 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LY-379,268 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:191471-52-0 | ChEBI |
| Citations |
|---|