EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO5 |
| Net Charge | 0 |
| Average Mass | 187.151 |
| Monoisotopic Mass | 187.04807 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)[C@]1([H])OC[C@@]2(N)C(=O)O |
| InChI | InChI=1S/C7H9NO5/c8-7(6(11)12)1-13-4-2(3(4)7)5(9)10/h2-4H,1,8H2,(H,9,10)(H,11,12)/t2-,3-,4+,7+/m1/s1 |
| InChIKey | YASVRZWVUGJELU-MDASVERJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY 379268 (CHEBI:192545) has role antipsychotic agent (CHEBI:35476) |
| LY 379268 (CHEBI:192545) has role anxiolytic drug (CHEBI:35474) |
| LY 379268 (CHEBI:192545) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| LY 379268 (CHEBI:192545) has role neuroprotective agent (CHEBI:63726) |
| LY 379268 (CHEBI:192545) is a amino dicarboxylic acid (CHEBI:36164) |
| LY 379268 (CHEBI:192545) is a bridged compound (CHEBI:35990) |
| LY 379268 (CHEBI:192545) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| (1R,4R,5S,6R)-4-amino-2-oxabicyclo[3.1.0]hexane-4,6-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| LY-379,268 | ChEBI |
| LY-379268 | ChEBI |
| LY379268 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LY-379,268 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:191471-52-0 | ChEBI |
| Citations |
|---|