EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O5 |
| Net Charge | 0 |
| Average Mass | 356.503 |
| Monoisotopic Mass | 356.25627 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16-,17+,18-,19+/m0/s1 |
| InChIKey | DZUXGQBLFALXCR-PUCCXBQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus Musculus (ncbitaxon:10090) | |||
| lung (BTO:0000763) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] | |
| serum (BTO:0001239) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] | |
| colon (BTO:0000269) | MetaboLights (MTBLS4590) | Strain: BALB/c [EFO:0000602] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-iso-prostaglandin F1alpha (CHEBI:192540) is a prostanoid (CHEBI:26347) |
| Incoming Relation(s) |
| 8-iso-prostaglandin F1alpha(1-) (CHEBI:747285) is conjugate base of 8-iso-prostaglandin F1alpha (CHEBI:192540) |
| IUPAC Name |
|---|
| 7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9339243 | ChemSpider |