EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O3 |
| Net Charge | 0 |
| Average Mass | 192.214 |
| Monoisotopic Mass | 192.07864 |
| SMILES | Cc1ccc2c(c1O)C(=O)OC(C)C2 |
| InChI | InChI=1S/C11H12O3/c1-6-3-4-8-5-7(2)14-11(13)9(8)10(6)12/h3-4,7,12H,5H2,1-2H3 |
| InChIKey | SLYRNFYMGDTQEZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camponotus rufipes (ncbitaxon:105048) | - | DOI (10.1007/BF01134489) | |
| Camponotus silvicola (ncbitaxon:105053) | - | DOI (10.1007/BF01134489) |
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methylmellein (CHEBI:192524) has functional parent mellein (CHEBI:38760) |
| 7-methylmellein (CHEBI:192524) has role Aspergillus metabolite (CHEBI:76956) |
| 7-methylmellein (CHEBI:192524) has role animal metabolite (CHEBI:75767) |
| 7-methylmellein (CHEBI:192524) has role insect attractant (CHEBI:24850) |
| 7-methylmellein (CHEBI:192524) has role pheromone (CHEBI:26013) |
| 7-methylmellein (CHEBI:192524) is a isochromanes (CHEBI:38762) |
| IUPAC Name |
|---|
| 8-hydroxy-3,7-dimethyl-3,4-dihydro-1H-isochromen-1-one |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-8-hydroxy-3,7-dimethylisocoumarin | ChEBI |
| 7-MM | SUBMITTER |
| 8-hydroxy-3,7-dimethyl-3,4-dihydro-1H-2-benzopyran-1-one | IUPAC |
| 8-hydroxy-3,7-dimethyl-3,4-dihydroisochromen-1-one | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 7-methylmellein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22718 | MetaCyc |
| US20160326129 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1799965-79-9 | ChEBI |
| Citations |
|---|