EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N4O10P2 |
| Net Charge | 0 |
| Average Mass | 412.188 |
| Monoisotopic Mass | 412.01852 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H14N4O10P2/c15-5-1-7(14-4-13-8-9(14)11-3-12-10(8)16)23-6(5)2-22-26(20,21)24-25(17,18)19/h3-7,15H,1-2H2,(H,20,21)(H,11,12,16)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
| InChIKey | BKUSIKGSPSFQAC-RRKCRQDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has functional parent IMP (CHEBI:17202) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has role Escherichia coli metabolite (CHEBI:76971) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has role human metabolite (CHEBI:77746) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has role mouse metabolite (CHEBI:75771) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) is a deoxyinosine phosphate (CHEBI:23630) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) is a purine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37036) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) is conjugate acid of 2'-deoxyinosine 5'-diphosphate(3−) (CHEBI:62286) |
| Incoming Relation(s) |
| 2'-deoxyinosine 5'-diphosphate(3−) (CHEBI:62286) is conjugate base of 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) |
| IUPAC Name |
|---|
| 2'-deoxyinosine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| dIDP | KEGG COMPOUND |
| 2'-Deoxyinosine-5'-diphosphate | KEGG COMPOUND |
| 2'-Deoxyinosine 5'-diphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01344 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7397772 | Beilstein |