EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H19F5N6OS |
| Net Charge | 0 |
| Average Mass | 558.536 |
| Monoisotopic Mass | 558.12612 |
| SMILES | Cc1cc(C)c(-n2ccn3nc(-c4cccnc4)cc23)cc1NC(=O)c1cc(C#N)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C26H19F5N6OS/c1-16-8-17(2)24(36-6-7-37-25(36)13-23(35-37)19-4-3-5-33-15-19)12-22(16)34-26(38)20-9-18(14-32)10-21(11-20)39(27,28,29,30)31/h3-13,15H,1-2H3,(H,34,38) |
| InChIKey | MPASHPJAIUOWCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAY-826 (CHEBI:192483) has role antineoplastic agent (CHEBI:35610) |
| BAY-826 (CHEBI:192483) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| BAY-826 (CHEBI:192483) is a benzamides (CHEBI:22702) |
| BAY-826 (CHEBI:192483) is a imidazopyrazole (CHEBI:192493) |
| BAY-826 (CHEBI:192483) is a nitrile (CHEBI:18379) |
| BAY-826 (CHEBI:192483) is a organofluorine compound (CHEBI:37143) |
| BAY-826 (CHEBI:192483) is a organosulfur compound (CHEBI:33261) |
| BAY-826 (CHEBI:192483) is a pyridines (CHEBI:26421) |
| BAY-826 (CHEBI:192483) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-cyano-N-{2,4-dimethyl-5-[6-(pyridin-3-yl)-1H-imidazo[1,2-b]pyrazol-1-yl]phenyl}-5-(pentafluoro-λ6-sulfanyl)benzamide |
| Synonyms | Source |
|---|---|
| BAY 826 | ChEBI |
| BAY826 | ChEBI |
| [3-cyano-5-[[[2,4-dimethyl-5-[6-(3-pyridinyl)-1H-imidazo[1,2-b]pyrazol-1-yl]phenyl]amino]carbonyl]phenyl]pentafluorosulfur | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US9394309 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1448316-08-2 | ChEBI |
| Citations |
|---|