EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:192419 - Conessine dihydrobromide
| Formula | C24H40N2.2HBr |
| Net Charge | 0 |
| Average Mass | 518.422 |
| Monoisotopic Mass | 516.17147 |
| SMILES | Br.Br.[H][C@@]12CC=C3C[C@@H](N(C)C)CC[C@]3(C)[C@@]1([H])CC[C@]13CN(C)[C@@H](C)[C@@]1([H])CC[C@@]23[H] |
| InChI | InChI=1S/C24H40N2.2BrH/c1-16-20-8-9-22-19-7-6-17-14-18(25(3)4)10-12-23(17,2)21(19)11-13-24(20,22)15-26(16)5;;/h6,16,18-22H,7-15H2,1-5H3;2*1H/t16-,18-,19+,20+,21-,22-,23-,24-;;/m0../s1 |
| InChIKey | YYTFAPMEQOGSRL-VEOCRSHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus radiata (ncbitaxon:3347) | leaf (BTO:0000713) | MetaboLights (MTBLS4567) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Conessine dihydrobromide (CHEBI:192419) is a steroid alkaloid (CHEBI:26767) |
| IUPAC Name |
|---|
| (1R,2S,5S,6S,9R,12S,13R,16S)-N,N,6,7,13-pentamethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-amine;dihydrobromide |