EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3D3FO2 |
| Net Charge | 0 |
| Average Mass | 93.071 |
| Monoisotopic Mass | 93.03054 |
| SMILES | [2H]OC(=O)C(F)=C([2H])[2H] |
| InChI | InChI=1S/C3H3FO2/c1-2(4)3(5)6/h1H2,(H,5,6)/i1D2/hD |
| InChIKey | TYCFGHUTYSLISP-RIAYTAFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus radiata (ncbitaxon:3347) | leaf (BTO:0000713) | MetaboLights (MTBLS4567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deuterio 3,3-dideuterio-2-fluoroprop-2-enoate (CHEBI:192416) is a carboxylic acid (CHEBI:33575) |
| deuterio 3,3-dideuterio-2-fluoroprop-2-enoate (CHEBI:192416) is a organohalogen compound (CHEBI:17792) |
| IUPAC Name |
|---|
| deuterio 3,3-dideuterio-2-luoroprop-2-enoate |