EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6P |
| Net Charge | -3 |
| Average Mass | 207.098 |
| Monoisotopic Mass | 207.00750 |
| SMILES | CCCC=C(OP(=O)([O-])[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H11O6P/c1-2-3-4-5(6(7)8)12-13(9,10)11/h4H,2-3H2,1H3,(H,7,8)(H2,9,10,11)/p-3 |
| InChIKey | LBHRVXNJFHUZKK-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus radiata (ncbitaxon:3347) | leaf (BTO:0000713) | MetaboLights (MTBLS4567) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-propylphosphoenolpyruvate (CHEBI:192404) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 2-phosphonatooxyhex-2-enoate |