EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O10 |
| Net Charge | 0 |
| Average Mass | 548.544 |
| Monoisotopic Mass | 548.16825 |
| SMILES | CC(=O)c1c(O)c(C)c(O)c(Cc2c(O)c3c(c(C(=O)/C=C/c4ccc(O)c(O)c4)c2O)OC(C)(C)C=C3)c1O |
| InChI | InChI=1S/C30H28O10/c1-13-24(35)17(27(38)22(14(2)31)25(13)36)12-18-26(37)16-9-10-30(3,4)40-29(16)23(28(18)39)20(33)8-6-15-5-7-19(32)21(34)11-15/h5-11,32,34-39H,12H2,1-4H3/b8-6+ |
| InChIKey | LXWIYZXWHIMUOX-SOFGYWHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus radiata (ncbitaxon:3347) | leaf (BTO:0000713) | MetaboLights (MTBLS4567) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-Dihydroxyrottlerin (CHEBI:192400) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (E)-1-[6-[(3-acetyl-2,4,6-trihydroxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethylchromen-8-yl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| 4475800 | ChemSpider |
| LMPK12120269 | LIPID MAPS |