EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | COc1cc2c(cc1O)CCN1CC=C3C=C[C@H](OC)C[C@]321 |
| InChI | InChI=1S/C18H21NO3/c1-21-14-4-3-13-6-8-19-7-5-12-9-16(20)17(22-2)10-15(12)18(13,19)11-14/h3-4,6,9-10,14,20H,5,7-8,11H2,1-2H3/t14-,18-/m0/s1 |
| InChIKey | BDIVMECULLJBMU-KSSFIOAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | - | PubMed (18116959) | |
| Erythrina addisoniae (ncbitaxon:2590682) | seed (BTO:0001226) | PubMed (19387573) | |
| Erythrina americana (ncbitaxon:932743) | seed (BTO:0001226) | DOI (10.1021/jf9600768) | |
| Erythrina corallodendron (ncbitaxon:3843) | stem (BTO:0001300) | PubMed (34396757) | |
| Erythrina crista-galli (ncbitaxon:49817) | - | PubMed (20240594) | |
| Erythrina latissima (ncbitaxon:3844) | seed (BTO:0001226) | PubMed (30602319) | |
| Erythrina suberosa (ncbitaxon:1288013) | |||
| seed (BTO:0001226) | PubMed (5348524 ) | ||
| flower (BTO:0000469) | DOI (10.1590/S0100-40422011000500015) |
| Roles Classification |
|---|
| Biological Roles: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. phytogenic insecticide An insecticide compound naturally occurring in plants. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erysodine (CHEBI:192381) has role antiparasitic agent (CHEBI:35442) |
| erysodine (CHEBI:192381) has role nicotinic antagonist (CHEBI:48878) |
| erysodine (CHEBI:192381) has role phytogenic insecticide (CHEBI:22917) |
| erysodine (CHEBI:192381) is a Erythrina alkaloid (CHEBI:192382) |
| erysodine (CHEBI:192381) is a aromatic ether (CHEBI:35618) |
| erysodine (CHEBI:192381) is a diether (CHEBI:46786) |
| erysodine (CHEBI:192381) is a organic heterotetracyclic compound (CHEBI:38163) |
| erysodine (CHEBI:192381) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3β,15-dimethoxy-1,2,6,7-tetradehydroerythrinan-16-ol |
| Synonyms | Source |
|---|---|
| 1,2,6,7-tetradehydro-3β,15-dimethoxyerythrinan-16-ol | ChEBI |
| (3β)-1,2,6,7-tetradehydro-3,15-dimethoxyerythrinan-16-ol | ChEBI |
| erysodin | KNApSAcK |
| (+)-erysodine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00019515 | KNApSAcK |
| HMDB0030255 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7290-03-1 | ChemIDplus |
| Citations |
|---|