EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O6S |
| Net Charge | 0 |
| Average Mass | 390.417 |
| Monoisotopic Mass | 390.08856 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O6S/c1-10(21)26-8-12-9-27-17-14(16(23)20(17)15(12)18(24)25)19-13(22)7-11-5-3-2-4-6-11/h2-6,14,17H,7-9H2,1H3,(H,19,22)(H,24,25)/t14-,17-/m1/s1 |
| InChIKey | GOFCPYKUMJBHBH-RHSMWYFYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefaloram (CHEBI:192380) has role antibacterial drug (CHEBI:36047) |
| cefaloram (CHEBI:192380) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| (6R,7R)-3-[(acetyloxy)methyl]-8-oxo-7-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| cefaloram | ChemIDplus |
| cefaloramo | ChemIDplus |
| cefaloramum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(Acetoxymethyl)-8-oxo-7-(phenylacetamido)-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid | ChemIDplus |
| cephaloram | ChEBI |
| Citations |
|---|