EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N4O6S |
| Net Charge | 0 |
| Average Mass | 416.415 |
| Monoisotopic Mass | 416.07906 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)c1nc2ccccc2nc1C(=O)O |
| InChI | InChI=1S/C18H16N4O6S/c1-18(2)12(17(27)28)22-14(24)11(15(22)29-18)21-13(23)9-10(16(25)26)20-8-6-4-3-5-7(8)19-9/h3-6,11-12,15H,1-2H3,(H,21,23)(H,25,26)(H,27,28)/t11-,12+,15-/m1/s1 |
| InChIKey | GPMSLJIYNWBYEL-TYNCELHUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinacillin (CHEBI:192379) has role antibacterial drug (CHEBI:36047) |
| quinacillin (CHEBI:192379) is a penicillin (CHEBI:17334) |
| quinacillin (CHEBI:192379) is a quinoxaline derivative (CHEBI:38771) |
| IUPAC Name |
|---|
| 3-{[(2S,5R,6R)-2-carboxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]carbamoyl}quinoxaline-2-carboxylic acid |
| INNs | Source |
|---|---|
| quinacilina | ChemIDplus |
| quinacillin | ChemIDplus |
| quinacilline | ChemIDplus |
| quinacillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-[(3-carboxyquinoxaline-2-carbonyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | ChEBI |
| 3-carboxy-2-quinoxalinylpenicillanic acid | ChemIDplus |
| (3-carboxy-2-quinoxalinyl)penicillin | ChemIDplus |
| 6-(3-Carboxy-2-chinoxalinecarboxamido)-3,3-dimethyl-7-oxo-4-thia-azabicyclo(3.2.0)heptan-2-carbonsaeure | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Quinacillin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1596-63-0 | ChemIDplus |
| Citations |
|---|