EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O2 |
| Net Charge | 0 |
| Average Mass | 350.422 |
| Monoisotopic Mass | 350.17428 |
| SMILES | C=CC(C)(C)c1ncnc1/C=C1\NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C20H22N4O2/c1-4-20(2,3)17-14(21-12-22-17)11-16-19(26)23-15(18(25)24-16)10-13-8-6-5-7-9-13/h4-9,11-12,15H,1,10H2,2-3H3,(H,21,22)(H,23,26)(H,24,25)/b16-11-/t15-/m0/s1 |
| InChIKey | GWMHBVLPNWHWGW-CNYBTUBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ustus (ncbitaxon:40382) | - | DOI (10.1016/S0960-894X(97)10104-4) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-phenylahistin (CHEBI:192360) has role Aspergillus metabolite (CHEBI:76956) |
| (−)-phenylahistin (CHEBI:192360) has role antineoplastic agent (CHEBI:35610) |
| (−)-phenylahistin (CHEBI:192360) is a halimide (CHEBI:192359) |
| (−)-phenylahistin (CHEBI:192360) is enantiomer of (+)-phenylahistin (CHEBI:192361) |
| Incoming Relation(s) |
| (+)-phenylahistin (CHEBI:192361) is enantiomer of (−)-phenylahistin (CHEBI:192360) |
| IUPAC Name |
|---|
| (3S,6Z)-3-benzyl-6-{[5-(2-methylbut-3-en-2-yl)-1H-imidazol-4-yl]methylidene}piperazine-2,5-dione |
| Synonym | Source |
|---|---|
| (S)-phenylahistin | ChEBI |
| Citations |
|---|