EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O |
| Net Charge | 0 |
| Average Mass | 245.286 |
| Monoisotopic Mass | 245.12766 |
| SMILES | CC(C)c1cn2c3c(ncn3C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C12H15N5O/c1-7(2)8-5-17-10-9(13-6-15(10)3)11(18)16(4)12(17)14-8/h5-7H,1-4H3 |
| InChIKey | QTBYUXWWYMDZJH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. SCSIO Ind09F01 (ncbitaxon:1654592) | - | PubMed (25944530) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acremolin B (CHEBI:192357) has role Aspergillus metabolite (CHEBI:76956) |
| acremolin B (CHEBI:192357) has role marine metabolite (CHEBI:76507) |
| acremolin B (CHEBI:192357) is a alkaloid (CHEBI:22315) |
| acremolin B (CHEBI:192357) is a imidazopurine (CHEBI:39202) |
| IUPAC Name |
|---|
| 1,5-dimethyl-7-(propan-2-yl)-1H-imidazo[2,1-b]purin-4(5H)-one |
| Citations |
|---|