EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7S |
| Net Charge | 0 |
| Average Mass | 362.359 |
| Monoisotopic Mass | 362.04602 |
| SMILES | COC(=O)c1c(S(C)=O)ccc2oc3cc(CO)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C17H14O7S/c1-23-17(21)15-12(25(2)22)4-3-10-14(15)16(20)13-9(19)5-8(7-18)6-11(13)24-10/h3-6,18-19H,7H2,1-2H3 |
| InChIKey | AYCYZLASDOHFHP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. SCSIO Ind09F01 (ncbitaxon:1654592) | - | PubMed (25944530) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sydoxanthone C (CHEBI:192356) has role Aspergillus metabolite (CHEBI:76956) |
| sydoxanthone C (CHEBI:192356) has role marine metabolite (CHEBI:76507) |
| sydoxanthone C (CHEBI:192356) is a aromatic ester (CHEBI:62732) |
| sydoxanthone C (CHEBI:192356) is a methyl ester (CHEBI:25248) |
| sydoxanthone C (CHEBI:192356) is a phenols (CHEBI:33853) |
| sydoxanthone C (CHEBI:192356) is a sulfoxide (CHEBI:22063) |
| sydoxanthone C (CHEBI:192356) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-6-(hydroxymethyl)-2-(methylsulfinyl)-9-oxo-9H-xanthene-1-carboxylate |
| Synonym | Source |
|---|---|
| methyl 8-hydroxy-6-(hydroxymethyl)-2-(methanesulfinyl)-9-oxo-9H-xanthene-1-carboxylate | IUPAC |
| Citations |
|---|