EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | C=C(C)C(O)COc1ccc(CC(=O)OC)cc1 |
| InChI | InChI=1S/C14H18O4/c1-10(2)13(15)9-18-12-6-4-11(5-7-12)8-14(16)17-3/h4-7,13,15H,1,8-9H2,2-3H3 |
| InChIKey | PYYHOQKLLMMOGK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus westerdijkiae (ncbitaxon:357447) | - | PubMed ( 25325177) | Strain: SCSIO 05233 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| westerdijkin A (CHEBI:192355) has functional parent 2-[4-(2-hydroxy-3-methylbut-3-enoxy)phenyl]acetic acid (CHEBI:181540) |
| westerdijkin A (CHEBI:192355) has role Aspergillus metabolite (CHEBI:76956) |
| westerdijkin A (CHEBI:192355) has role marine metabolite (CHEBI:76507) |
| westerdijkin A (CHEBI:192355) is a aromatic ether (CHEBI:35618) |
| westerdijkin A (CHEBI:192355) is a benzenes (CHEBI:22712) |
| westerdijkin A (CHEBI:192355) is a methyl ester (CHEBI:25248) |
| westerdijkin A (CHEBI:192355) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| methyl {4-[(2-hydroxy-3-methylbut-3-en-1-yl)oxy]phenyl}acetate |
| Citations |
|---|