EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O3 |
| Net Charge | 0 |
| Average Mass | 238.327 |
| Monoisotopic Mass | 238.15689 |
| SMILES | [H][C@@]1(C(=C)CO)C[C@]2([H])[C@@]3([H])C[C@@H](O)[C@H](O)[C@@H](C)[C@]32C1 |
| InChI | InChI=1S/C14H22O3/c1-7(6-15)9-3-10-11-4-12(16)13(17)8(2)14(10,11)5-9/h8-13,15-17H,1,3-6H2,2H3/t8-,9-,10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | AIZWGRSMWNJPSB-UAZQNFISSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anisodus tanguticus (ncbitaxon:243964) | - | DOI (10.1002/cjoc.202100524) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisotanol C (CHEBI:192353) has role angiogenesis inhibitor (CHEBI:48422) |
| anisotanol C (CHEBI:192353) has role plant metabolite (CHEBI:76924) |
| anisotanol C (CHEBI:192353) is a carbotricyclic compound (CHEBI:38032) |
| anisotanol C (CHEBI:192353) is a primary allylic alcohol (CHEBI:134394) |
| anisotanol C (CHEBI:192353) is a sesquiterpenoid (CHEBI:26658) |
| anisotanol C (CHEBI:192353) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2R,3aR,3bR,5R,6R,7S,7aS)-2-(3-hydroxyprop-1-en-2-yl)-7-methyloctahydro-1H-cyclopenta[1,3]cyclopropa[1,2]benzene-5,6-diol |