EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O14 |
| Net Charge | 0 |
| Average Mass | 632.530 |
| Monoisotopic Mass | 632.11661 |
| SMILES | COC(=O)c1cc(OC)c(O)c2occ(-c3c(C(C)=O)cc4c(=O)c5c(C(=O)OC)cc(OC)c(O)c5oc4c3C(C)=O)c(=O)c12 |
| InChI | InChI=1S/C32H24O14/c1-11(33)13-7-16-24(35)23-15(32(40)44-6)9-19(42-4)27(38)30(23)46-28(16)20(12(2)34)21(13)17-10-45-29-22(25(17)36)14(31(39)43-5)8-18(41-3)26(29)37/h7-10,37-38H,1-6H3 |
| InChIKey | VRJOYEIUCUFMGO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium sp. (ncbitaxon:1769349) | - | DOI (10.1002/ejoc.200601020) | Strain: Gö 100/2 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetocyclinone C (CHEBI:192347) has role fungal metabolite (CHEBI:76946) |
| chaetocyclinone C (CHEBI:192347) has role marine metabolite (CHEBI:76507) |
| chaetocyclinone C (CHEBI:192347) is a aromatic ether (CHEBI:35618) |
| chaetocyclinone C (CHEBI:192347) is a chromones (CHEBI:23238) |
| chaetocyclinone C (CHEBI:192347) is a cyclic ether (CHEBI:37407) |
| chaetocyclinone C (CHEBI:192347) is a cyclic ketone (CHEBI:3992) |
| chaetocyclinone C (CHEBI:192347) is a diester (CHEBI:51307) |
| chaetocyclinone C (CHEBI:192347) is a methyl ester (CHEBI:25248) |
| chaetocyclinone C (CHEBI:192347) is a methyl ketone (CHEBI:51867) |
| chaetocyclinone C (CHEBI:192347) is a organic heterotricyclic compound (CHEBI:26979) |
| chaetocyclinone C (CHEBI:192347) is a phenols (CHEBI:33853) |
| chaetocyclinone C (CHEBI:192347) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| methyl 5,7-diacetyl-4-hydroxy-6-[8-hydroxy-7-methoxy-5-(methoxycarbonyl)-4-oxo-4H-chromen-3-yl]-3-methoxy-9-oxo-9H-xanthene-1-carboxylate |
| Synonym | Source |
|---|---|
| methyl 5,7-diacetyl-4-hydroxy-6-[8-hydroxy-7-methoxy-5-(methoxycarbonyl)-4-oxo-4H-1-benzopyran-3-yl]-3-methoxy-9-oxo-9H-xanthene-1-carboxylate | IUPAC |